| Identification |
| Name: | 2-Azabicyclo[2.2.1]hept-5-en-3-one,(1R,4S)- |
| Synonyms: | 2-Azabicyclo[2.2.1]hept-5-en-3-one,(1R)-;(-)-2-Azabicyclo[2.2.1]hept-5-en-3-one;(1R)-(-)-2-Azabicyclo[2.2.1]hept-5-en-3-one;(1R,4S)-(-)-2-Azabicyclo[2.2.1]hept-5-en-3-one; |
| CAS: | 79200-56-9 |
| EINECS: | 418-530-1 |
| Molecular Formula: | C6H7NO |
| Molecular Weight: | 109.1259 |
| InChI: | InChI=1/C6H7NO/c8-6-4-1-2-5(3-4)7-6/h1-2,4-5H,3H2,(H,7,8)/t4-,5+/m1/s1 |
| Molecular Structure: |
![(C6H7NO) 2-Azabicyclo[2.2.1]hept-5-en-3-one,(1R)-;(-)-2-Azabicyclo[2.2.1]hept-5-en-3-one;(1R)-(-)-2-Azabicycl...](https://img1.guidechem.com/chem/e/dict/40/79200-56-9.jpg) |
| Properties |
| Density: | 1.198 g/cm3 |
| Refractive index: | 1.545 |
| Appearance: | Off-white to beige crystals or crystalline powder |
| Usage: | Abacavir intermediate. Used as an intermediate in the synthesis of carbocyclic sugar amines, carbanucleosides, and carbocyclic dinucleotide analogues. |
| Safety Data |
| Hazard Symbols |
Xn: Harmful
|
| |
 |