Identification |
Name: | 2-Azabicyclo[2.2.1]hept-5-en-3-one,(1R,4S)- |
Synonyms: | 2-Azabicyclo[2.2.1]hept-5-en-3-one,(1R)-;(-)-2-Azabicyclo[2.2.1]hept-5-en-3-one;(1R)-(-)-2-Azabicyclo[2.2.1]hept-5-en-3-one;(1R,4S)-(-)-2-Azabicyclo[2.2.1]hept-5-en-3-one; |
CAS: | 79200-56-9 |
EINECS: | 418-530-1 |
Molecular Formula: | C6H7NO |
Molecular Weight: | 109.1259 |
InChI: | InChI=1/C6H7NO/c8-6-4-1-2-5(3-4)7-6/h1-2,4-5H,3H2,(H,7,8)/t4-,5+/m1/s1 |
Molecular Structure: |
|
Properties |
Density: | 1.198 g/cm3 |
Refractive index: | 1.545 |
Appearance: | Off-white to beige crystals or crystalline powder |
Usage: | Abacavir intermediate. Used as an intermediate in the synthesis of carbocyclic sugar amines, carbanucleosides, and carbocyclic dinucleotide analogues. |
Safety Data |
Hazard Symbols |
Xn: Harmful
|
|
|