| Identification | |
| Name: | 1-Naphthalenamine,4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydro-N-methyl-, hydrochloride (1:1),(1S,4S)- |
| Synonyms: | 1-Naphthalenamine,4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydro-N-methyl-, hydrochloride, (1S,4S)-(9CI);(1S,4S)-4-(3,4-Dichlorophenyl)-1,2,3,4-tetrahydro-N-methyl-1-naphthalenaminehydrochloride;(1S,4S)-N-Methyl-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydro-1-naphthalenaminehydrochloride;Altruline;Aremis;Atruline;Cp 51974-1;Dominum;Gladem;Lesefer;Lustral;Selectra;Sosser;Stimuloton;Zolof;Zoloft; |
| CAS: | 79559-97-0 |
| Molecular Formula: | C17H17Cl2N.HCl |
| Molecular Weight: | 306.22958 |
| InChI: | InChI=1S/C17H17Cl2N/c1-20-17-9-7-12(13-4-2-3-5-14(13)17)11-6-8-15(18)16(19)10-11/h2-6,8,10,12,17,20H,7,9H2,1H3/t12-,17-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Stability: | Store in Freezer |
| Water Solubility: | DMSO: ~26 mg/mL |
| Solubility: | DMSO: ~26 mg/mL |
| Appearance: | White to off-white crystal |
| Biological Activity: | Potent, orally active selective serotonin re-uptake inhibitor (SSRI) used clinically to treat depression. |
| Storage Temperature: | Desiccate at RT |
| Color: | white |
| Usage: | A selective serotonin reuptake inhibitor. Used as an antidepressant |
| Safety Data | |
 |
|
