| Identification |
| Name: | Benzene,1-ethynyl-4-(pentyloxy)- |
| Synonyms: | 1-Ethynyl-4-(pentyloxy)benzene;4-(Pentyloxy)phenylacetylene;4-(n-Pentyloxy)phenylacetylene; |
| CAS: | 79887-16-4 |
| Molecular Formula: | C13H16O |
| Molecular Weight: | 188.27 |
| InChI: | InChI=1/C13H16O/c1-3-5-6-11-14-13-9-7-12(4-2)8-10-13/h2,7-10H,3,5-6,11H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 0.96 g/cm3 |
| Refractive index: | 1.527 |
| Specification: |
1-Eth-1-ynyl-4-(pentyloxy)benzene , its cas register number is 79887-16-4. It also can be called 4-n-Pentylphenylacetylene ; and 1-Ethyl-4-(pentyloxy)benzene .
|
| Usage: |
1-Eth-1-ynyl-4-(pentyloxy)benzene (CAS NO.79887-16-4) has been used for intermediate of liquid crystals.
|
| Safety Data |
| |
 |