| Identification | |
| Name: | 8-Azoniabicyclo[3.2.1]octane,3-[(2-hydroxy-2-phenylacetyl)oxy]-8,8-dimethyl-, bromide (1:1), (3-endo)- |
| Synonyms: | 1aH,5aH-Tropanium, 3a-hydroxy-8-methyl-, bromide, mandelate (8CI);8-Methylhomatropinium bromide(6CI,7CI);Camatropine;Helbatropin;Homatrocel;Homatropil;Homolone;Mesopin;Methatropine;Methylhomatropinehydrobromide;NSC 34399;Novatrine;Novatropine;Sethyl; |
| CAS: | 80-49-9 |
| EINECS: | 201-284-0 |
| Molecular Formula: | C17H24NO3.Br |
| Molecular Weight: | 370.28 |
| InChI: | InChI=1/C17H24NO3.BrH/c1-18(2)13-8-9-14(18)11-15(10-13)21-17(20)16(19)12-6-4-3-5-7-12;/h3-7,13-16,19H,8-11H2,1-2H3;1H/q+1;/p-1/t13-,14?,15+,16?;/m0./s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1544 |
| Melting Point: | 192°C |
| Flash Point: | 197.7°C |
| Boiling Point: | 403.3°C at 760 mmHg |
| Density: | 1.21g/cm3 |
| Refractive index: | 1.588 |
| Specification: |
Mesopin (80-49-9) is used in conjunction with antacids or histamine H2-receptor antagonists in the treatment of peptic ulcers, gastric ulcers and duodenal ulcers, to reduce further gastric acid secretion and delay gastric emptying. |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 197.7°C |
| Safety Data | |
 |
|
