| Identification | |
| Name: | 2-Butenoic acid,2-methyl-, (2E)- |
| Synonyms: | 2-Butenoicacid, 2-methyl-, (E)-;Crotonic acid, 2-methyl-, (E)- (8CI);Tiglic acid(6CI,7CI);(E)-2-Methyl-2-butenoic acid;(E)-a-Methylcrotonic acid;Cevadic acid;NSC 44235;NSC 8999;Tiglinic acid;trans-2,3-Dimethylacrylic acid;trans-2-Methyl-2-butenoic acid;trans-a,b-Dimethylacrylic acid; |
| CAS: | 80-59-1 |
| EINECS: | 201-295-0 |
| Molecular Formula: | C5H8O2 |
| Molecular Weight: | 100.13 |
| InChI: | InChI=1/C5H8O2/c1-3-4(2)5(6)7/h3H,1-2H3,(H,6,7)/b4-3- |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3261 8/PG 2 |
| Melting Point: | 61-65 ºC |
| Flash Point: | 95.9°C |
| Boiling Point: | 198.4 ºC |
| Density: | 0.969 |
| Refractive index: | 1.45 |
| Water Solubility: | SOLUBLE IN HOT WATER |
| Solubility: | SOLUBLE IN HOT WATER |
| Appearance: | white to beige crystalline powder and chunks |
| Specification: | WHITE TO BEIGE CRYSTALLINE POWDER AND CHUNKS Safety Statements:26-36/37/39-45-24/25-27 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 24/25:Avoid contact with skin and eyes 27:Take off immediately all contaminated clothing |
| Packinggroup: | III |
| HS Code: | 29161980 |
| Flash Point: | 95.9°C |
| Color: | Triclinic plates, rods from water Thick, syrupy liquid or colorless crystals Tablets |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
