| Identification | |
| Name: | Propanedioic acid,2-hydroxy- |
| Synonyms: | Propanedioicacid, hydroxy- (9CI); Tartronic acid (6CI,8CI); Hydroxymalonic acid;Hydroxypropanedioic acid; NSC 36171; a-Hydroxymalonic acid |
| CAS: | 80-69-3 |
| EINECS: | 201-301-1 |
| Molecular Formula: | C3H4 O5 |
| Molecular Weight: | 120.06 |
| InChI: | InChI=1/C3H4O5/c4-1(2(5)6)3(7)8/h1,4H,(H,5,6)(H,7,8) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 253°C |
| Boiling Point: | 471.4°C at 760 mmHg |
| Density: | 1.841g/cm3 |
| Refractive index: | 1.543 |
| Specification: | Safety Statements:22-26-36/37/39-36 22:Do not breathe dust 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 36:Wear suitable protective clothing |
| Flash Point: | 253°C |
| Storage Temperature: | 2-8°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
