| Identification | |
| Name: | 1,1,3,3-Tetramethylguanidine |
| Synonyms: | N,N,N',N'-tetramethyl-guanidine; N,N'-tetramethylguanidine; Tetramethylguanidine; TMG; 1,1,3,3-Tetermethyl Guanidine |
| CAS: | 80-70-6 |
| EINECS: | 201-302-7 |
| Molecular Formula: | C5H13N3 |
| Molecular Weight: | 115.18 |
| InChI: | InChI=1/C5H13N3/c1-7(2)5(6)8(3)4/h6H,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 170kgs |
| Density: | 0.918 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents, mineral and organic acids, carbon dioxide. Air-sensitive. |
| Refractive index: | 1.467-1.469 |
| Water Solubility: | miscible |
| Solubility: | miscible |
| Appearance: | Clear liquid |
| Specification: |
?1,1,3,3-Tetramethylguanidine (CAS NO.80-70-6) is also named as AI3-51030 ; CCRIS 6689 ; N,N,N',N'-Tetramethylguanidine ; NSC 148309 ; Guanidine, 1,1,3,3-tetramethyl- (8CI) ; Guanidine, N,N,N',N'-tetramethyl-?.?1,1,3,3-Tetramethylguanidine (CAS NO.80-70-6)?is a strong amine base with a higher pKa than typical amines. It is highly water soluble so easily removed from other chemicals in a chemical process. |
| Packinggroup: | II |
| HS Code: | 29252000 |
| Storage Temperature: | 2-8°C |
| Usage: | Tetramethylguanidine (TMG) is used as polyurethane foam catalyst, as accelerator for the syntheses of polysulfured rubber, as a strong base in the photochemical (e.g. couplers) and in the pharmaceutical (e.g. steroids) industries. Product Data Sheet |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
