| Identification | |
| Name: | Essential oils, clove |
| Synonyms: | Oils,clove;Clove bud oil;Clove leaf oil;Clove stemoil;Clove stem oil;Essential clove oil;Essential oils, clove leaf;Eugenia caryophyllata bud oil;Eugenia caryophyllata leafoil;Oil of Clove;Oils, Eugenia caryophyllatabud;Oils,Syzygium aromaticum bud;Oils, Syzygiumaromaticum stem;Oils, clove bud;Oils, clove inflorescence;Oils, clove leaf;Oils, clove stem;Oils, essential, clove stem;Syzygiumaromaticum leaf oil;Syzygium aromaticum oil; |
| CAS: | 8000-34-8 |
| EINECS: | 215-185-5 |
| Molecular Formula: | Unspecified |
| Molecular Weight: | 417.92902 |
| InChI: | InChI=1S/C18H21ClN2.C4H7NO3/c1-21(2)11-9-17-16-8-7-15(19)12-14(16)6-5-13-4-3-10-20-18(13)17;1-3(6)5-2-4(7)8/h3-4,7-8,10,12,17H,5-6,9,11H2,1-2H3;2H2,1H3,(H,5,6)(H,7,8) |
| Molecular Structure: |  |
| Properties | |
| Boiling Point: | ca. 250 C |
| Density: | 1.04 |
| Stability: | Stable. Probably combustible. |
| Refractive index: | 1.521 |
| Water Solubility: | negligible Stability Stable. Probably combustible. Toxicology Not believed to present a risk to health. Toxicity data (The meaning of any toxicological abbreviat |
| Solubility: | negligible
|
| Appearance: | colourless to pale yellow liquid with a characteristic smell |
| Specification: |
?Clove oil ,its cas register number is 8000-34-8. It also can be called Clove stem oil ; Benesal ; Clove leaf oil ; Clove oil and Clove bud or leave oil . |
| Report: |
Reported in EPA TSCA Inventory. |
| Storage Temperature: | Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Perfumery. |
| Safety Data | |
 |
|
