| Identification | |
| Name: | Aminopyrine-barbital |
| Synonyms: | 5,5-diethyl-1,3-diazinane-2,4,6-trione: 4-dimethylamino-1,5-dimethyl-2 -phenyl-pyrazol-3-one;Veramid;PYRABITAL |
| CAS: | 8015-18-7 |
| Molecular Formula: | C13H17N3O . C8H12N2O3 |
| Molecular Weight: | 415.491 |
| InChI: | InChI=1/C13H17N3O.C8H12N2O3/c1-10-12(14(2)3)13(17)16(15(10)4)11-8-6-5-7-9-11;1-3-8(4-2)5(11)9-7(13)10-6(8)12/h5-9H,1-4H3;3-4H2,1-2H3,(H2,9,10,11,12,13) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 125.9°C |
| Boiling Point: | 319.7°C at 760 mmHg |
| Specification: |
Aminopyrine-barbital (CAS NO.8015-18-7) is moderate toxic. It is flammable. Aminopyrine-barbital (CAS NO.8015-18-7) will produce toxic nitrogen oxide fumes when buring. So the storage environment should be ventilate, low-temperature and dry.So the storage environment should be ventilate, low-temperature and dry. |
| Flash Point: | 125.9°C |
| Safety Data | |
 |
|
