| Identification | |
| Name: | 2,6-Octadien-1-ol,3,7-dimethyl-, 1-acetate, (2E)- |
| Synonyms: | 2,6-Octadien-1-ol,3,7-dimethyl-, acetate, (2E)- (9CI); 2,6-Octadien-1-ol, 3,7-dimethyl-, acetate,(E)- (8CI); Geraniol acetate (6CI); (E)-3,7-Dimethyl-2,6-octadien-1-ol acetate;(E)-3,7-Dimethyl-2,6-octadienyl acetate; Acetic acid(2E)-3,7-dimethyl-2,6-octadienyl ester; Acetic acid geraniol ester; Bay pine(oyster) oil; Geranyl acetate; Geranyl ethanoate; NSC 2584;trans-1-Acetoxy-3,7-dimethyl-2,6-octadiene;trans-3,7-Dimethyl-2,6-octadien-1-yl acetate; trans-Geranyl acetate; b-Geranyl acetate |
| CAS: | 8022-83-1 |
| Molecular Formula: | C12H20 O2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1S/C12H20O2/c1-10(2)6-5-7-11(3)8-9-14-12(4)13/h6,8H,5,7,9H2,1-4H3/b11-8+ |
| Molecular Structure: |  |
| Properties | |
| Boiling Point: | Approx. 242 deg C with decomposition. |
| Solubility: | 1.8 IN 70% ALCOHOL; SOL IN MOST ORG SOLVENTS Soluble in most fixed oils; slightly soluble in propylene glycol. Solubility in alcohol: 1 mL in 9 mL 70% alcohol Insoluble in glycerol; soluble in alcohol, ether MISCIBLE WITH ETHER In water, 6.8 mg/L at 25 deg C (est) |
| Color: | Clear, colorless liquid |
| Safety Data | |
 |
|
