| Identification | |
| Name: | Boronic acid,B-(4-methyl-3-nitrophenyl)- |
| Synonyms: | Boronicacid, (4-methyl-3-nitrophenyl)- (9CI);p-Tolueneboronic acid, 3-nitro- (6CI);(4-Methyl-3-nitrophenyl)boronic acid;3-Nitro-4-methylbenzeneboronic acid; |
| CAS: | 80500-27-2 |
| EINECS: | -0 |
| Molecular Formula: | C7H8BNO4 |
| Molecular Weight: | 180.95 |
| InChI: | InChI=1/C7H8BNO4/c1-5-2-3-6(8(10)11)4-7(5)9(12)13/h2-4,10-11H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.33g/cm3 |
| Refractive index: | 1.563 |
| Appearance: | white to light yellow crystal powder |
| Specification: | white to light yellow crystal powder usageEng:Reactant for:• ;Preparation of inhibitors of lactate dehydrogenase against cancer cell proliferation1• ;Suzuki-Miyaura coupling reactions2,3• ;Preparation of imidazothiazoles as iodide efflux inhibitors in thyrocytes4 Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Usage: | Reactant for:• ;Preparation of inhibitors of lactate dehydrogenase against cancer cell proliferation1• ;Suzuki-Miyaura coupling reactions2,3• ;Preparation of imidazothiazoles as iodide efflux inhibitors in thyrocytes4 |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
