| Identification | |
| Name: | Benzenamine,4-(3-pyridinyloxy)- |
| Synonyms: | Pyridine,3-(p-aminophenoxy)- (6CI);3-(4-Aminophenoxy)pyridine;4-(3-Pyridyloxy)aniline;4-(Pyridin-3-yloxy)aniline;4-(Pyridin-3-yloxy)phenylamine; |
| CAS: | 80650-45-9 |
| Molecular Formula: | C11H10N2O |
| Molecular Weight: | 186.21 |
| InChI: | InChI=1/C11H10N2O/c12-9-3-5-10(6-4-9)14-11-2-1-7-13-8-11/h1-8H,12H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.197 g/cm3 |
| Refractive index: | 1.625 |
| Specification: |
The IUPAC name of 4-(3-Pyridinyloxy)phenylamine is 4-pyridin-3-yloxyaniline . With the CAS registry number 80650-45-9, it is also named as 4-(Pyridin-3-yloxy)aniline ; Benzenamine, 4-(3-pyridinyloxy)- ; 4-(3-Pyridinyloxy)aniline ; 4-(Pyridin-3-yloxy)phenylamine ; 4-(Pyridin-3-yloxy)-phenylamine . We can analyse that H bond acceptors is 3 and H bond donors is 2. People can use the following data to convert to the molecule structure. SMILES: O(c1ccc(N)cc1)c2cccnc2; InChI: InChI=1/C11H10N2O/c12-9-3-5-10(6-4-9)14-11-2-1-7-13-8-11/h1-8H,12H2; InChIKey: ZSLIXJKSPVCNHZ-UHFFFAOYAO; Std. InChI: InChI=1S/C11H10N2O/c12-9-3-5-10(6-4-9)14-11-2-1-7-13-8-11/h1-8H,12H2; Std. InChIKey: ZSLIXJKSPVCNHZ-UHFFFAOYSA-N. This product has marketed in China. Many companies supply this product. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
