| Identification | |
| Name: | 4-Thiazoleethanethioic acid, 2-amino-alpha-(methoxyimino)-, S-2-benzothiazolyl ester, (Z)- |
| Synonyms: | (Z)-2-[Methoxyimino]-2-(2-aminothiazol-4-yl)acetic acid S-2-benzothiazoleester;2-Amino-a-(methoxyimino)-4-thiazoleethanethioic acidS-2-benzothiazolyl ester;S-(Benzothiazol-2-yl)2-amino-a-(methoxyimino)thiazole-4-thioacetate;S-Benzothiazol-2-yl 2-(2-aminothiazol-4-yl)-2-(syn-methoxyimino)thioacetate; |
| CAS: | 80756-85-0 |
| EINECS: | 279-540-6 |
| Molecular Formula: | C13H10N4O2S3 |
| Molecular Weight: | 350.45 |
| InChI: | InChI=1S/C13H10N4O2S3/c1-19-17-10(8-6-20-12(14)15-8)11(18)22-13-16-7-4-2-3-5-9(7)21-13/h2-6H,1H3,(H2,14,15)/b17-10- |
| Molecular Structure: | ![(C13H10N4O2S3) (Z)-2-[Methoxyimino]-2-(2-aminothiazol-4-yl)acetic acid S-2-benzothiazoleester;2-Amino-a-(methoxyimi...](https://img1.guidechem.com/chem/e/dict/0/80756-85-0.jpg) |
| Properties | |
| Density: | 1.63 g/cm3 |
| Stability: | No data. |
| Appearance: | light yellow powder |
| Specification: |
4-Thiazoleethanethioic acid, 2-amino-alpha-(methoxyimino)-, S-2-benzothiazolyl ester, (Z)- , its cas register number is 80756-85-0. It also can be called (2-Mercaptobenzothiazolyl)-2-(2-aminothiazol-4-yl)-2-methoxyiminoacetate (syn) ; S-2-Benzothiazolyl (Z)-2-amino-alpha-(methoxyimino)-4-thiazoleethanethioate ; S-Benzothiazol-2-yl (Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(methoxyimino)thioacetate ; 4-Thiazoleethanethioic acid, 2-amino-alpha-(methoxyimino)-, S-2-benzothiazolyl ester, (Z)- ; S-Benzothiazol-2-yl (Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(methoxyimino)thioacetate .It is a light yellow powder. |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Usage: | Reagent used in the synthesis of Cefotaxime and related derivatives. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
