| Identification | |
| Name: | Trimec |
| Synonyms: | Kilmor;Trimec;Trex-San;Reed 10-51 brush killer;Acme industrial 10-51 brush killer;Benzoic acid, 3,6-dichloro-2-methoxy-, compd. with N-methylmethanamine (1:1), mixt. with N-methylmethanamine 2-(4-chloro-2-methylphenoxy)propanoate and N-methylmethanamine (2,4-dichlorophenoxy)acetate;AC1L4X4R;LS-36860;2-(4-chloro-2-methylphenoxy)propanoic acid; 3,6-dichloro-2-methoxybenzoic acid; 2-(2,4-dichlorophenoxy)acetic acid; N-methylmethanamine |
| CAS: | 8077-38-1 |
| Molecular Formula: | C10H11ClO3 . C8H6Cl2O3 . C8H6Cl2O3 . C2H7N |
| Molecular Weight: | 791.97146 |
| InChI: | InChI=1S/C10H11ClO3.2C8H6Cl2O3.3C2H7N/c1-6-5-8(11)3-4-9(6)14-7(2)10(12)13;1-13-7-5(10)3-2-4(9)6(7)8(11)12;9-5-1-2-7(6(10)3-5)13-4-8(11)12;3*1-3-2/h3-5,7H,1-2H3,(H,12,13);2-3H,1H3,(H,11,12);1-3H,4H2,(H,11,12);3*3H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 154.5°C |
| Boiling Point: | 331.9°Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
Trimec ,its CAS NO. is 8077-38-1,the synonyms is Acme industrial 10-51 brush killer ; Kilmor ; Reed 10-51 brush killer ; Trex-San ; Benzoic acid, 3,6-dichloro-2-methoxy-, compd. with N-methylmethanamine (1:1), mixt. with N-methylmethanamine 2-(4-chloro-2-methylphenoxy)propanoate and N-methylmethanamine (2,4-dichlorophenoxy)acetate . |
| Flash Point: | 154.5°C |
| Safety Data | |
| Hazard Symbols | |
 |
|
