| Identification | |
| Name: | Disperse Violet 28 |
| Synonyms: | C.I. 61102;Solvent Violet 31;1,4-Diamino-2,3-dichloro-9,10-anthraquinone;2,3-Dichloro-1,4-anthraquinonylenediamine; |
| CAS: | 81-42-5 |
| EINECS: | 201-348-8 |
| Molecular Formula: | C14H8Cl2N2O2 |
| Molecular Weight: | 307.13152 |
| InChI: | InChI=1S/C14H8Cl2N2O2/c15-9-10(16)12(18)8-7(11(9)17)13(19)5-3-1-2-4-6(5)14(8)20/h1-4H,17-18H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.637 |
| Refractive index: | 1.756 |
| Water Solubility: | soluble in acetone, ethanol and benzene |
| Solubility: | soluble in acetone, ethanol and benzene |
| Appearance: | dark purple powder |
| Specification: |
Disperse Violet 28 (CAS NO.81-42-5) also can be called 9,10-Anthracenedione, 1,4-diamino-2,3-dichloro- ; 1,4-Diamino-2,3-dichloroanthraquinone . Disperse Violet 28 (CAS NO.81-42-5) is dark purple powder. It is soluble in acetone, ethanol and benzene . |
| Safety Data | |
 |
|
