| Identification |
| Name: | Phosphinous chloride,dimethyl- (6CI,7CI,8CI,9CI) |
| Synonyms: | Chlorodimethylphosphine;Dimethylchlorophosphine; Dimethylphosphine chloride; Dimethylphosphinouschloride |
| CAS: | 811-62-1 |
| EINECS: | 212-372-3 |
| Molecular Formula: | C2H6 Cl P |
| Molecular Weight: | 96.49 |
| InChI: | InChI=1/C2H6ClP/c1-4(2)3/h1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 2845 |
| Density: | 1.22 |
| Water Solubility: | reacts violently with water |
| Solubility: | reacts violently with water |
| Appearance: | colorless to pale yellow liq. |
| Packinggroup: | I |
| Sensitive: | Air & Moisture Sensitive |
| Safety Data |
| |
 |
