| Identification |
| Name: | sebacic acid, compound with 2,2'-iminodiethanol (1:2) |
| Synonyms: | Sebacic acid, compound with 2,2'-iminodiethanol (1:2);bis[2-hydroxy-N-(2-hydroxyethyl)ethanaminium] decanedioate |
| CAS: | 81189-11-9 |
| EINECS: | 279-702-6 |
| Molecular Formula: | C18H40N2O8 |
| Molecular Weight: | 412.5188 |
| InChI: | InChI=1/C10H18O4.2C4H11NO2/c11-9(12)7-5-3-1-2-4-6-8-10(13)14;2*6-3-1-5-2-4-7/h1-8H2,(H,11,12)(H,13,14);2*5-7H,1-4H2 |
| Molecular Structure: |
![(C18H40N2O8) Sebacic acid, compound with 2,2'-iminodiethanol (1:2);bis[2-hydroxy-N-(2-hydroxyethyl)ethanaminium] ...](https://img.guidechem.com/pic/image/81189-11-9.gif) |
| Properties |
| Flash Point: | 372.4°C |
| Boiling Point: | 692.2°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 372.4°C |
| Safety Data |
| |
 |
