| Identification | |
| Name: | D-Glucose, labeled withcarbon-14 |
| Synonyms: | D-Glucose-14C(7CI); D-Glucose-U-14C; D-[U-14C]Glucose; Glucose labeled with carbon-14;Glucose-14C; Glucose-U-14C; [U-14C]Glucose |
| CAS: | 815-92-9 |
| EINECS: | 200-075-1 |
| Molecular Formula: | C6H12 O6 |
| Molecular Weight: | 180.1559 |
| InChI: | InChI=1/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h1,3-6,8-12H,2H2/t3-,4+,5+,6+/m0/s1 |
| Molecular Structure: | ![(C6H12O6) D-Glucose-14C(7CI); D-Glucose-U-14C; D-[U-14C]Glucose; Glucose labeled with carbon-14;Glucose-14C; G...](https://img1.guidechem.com/chem/e/dict/98/815-92-9.jpg) |
| Properties | |
| Transport: | UN 2910 7 |
| Melting Point: | 146 DEG C |
| Density: | 1.581 g/cm3 |
| Solubility: | SOL IN HOT METHANOL; SOL IN HOT PYRIDINE; SLIGHTLY SOL IN ACETONE; SOL IN WATER; SOL IN HOT ALC Slightly soluble in alcohol. In water, ... below a temperature of ca 100 deg C, the stable, crystalline form of D-glucose is the alpha-form, which crystallizes as a monohydrate below ca 50 deg C, above ca 100 deg C, the beta-anhydrous form, is most stable. water solubility = 1.2X10+6 mg/l @ 30 deg C |
| Appearance: | aqueous solution |
| Storage Temperature: | 2-8°C |
| Color: | Colorless crystals or white granular powder |
| Safety Data | |
| Hazard Symbols | |
 |
|
