| Identification | |
| Name: | 3-Furancarboxylicacid, 5-formyl-2-methyl-, methyl ester |
| Synonyms: | 4-Methoxycarbonyl-5-methylfuran-2-carboxaldehyde;Methyl 5-formyl-2-methylfuran-3-carboxylate |
| CAS: | 81661-26-9 |
| Molecular Formula: | C8H8 O4 |
| Molecular Weight: | 168.15 |
| InChI: | InChI=1/C8H8O4/c1-5-7(8(10)11-2)3-6(4-9)12-5/h3-4H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 83 °C |
| Flash Point: | 120.2°C |
| Boiling Point: | 275.2°C at 760 mmHg |
| Density: | 1.217g/cm3 |
| Refractive index: | 1.518 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 120.2°C |
| Safety Data | |
 |
|
