| Identification | |
| Name: | 1,3-Benzodioxole-5,6-diamine,hydrochloride (1:2) |
| Synonyms: | 1,3-Benzodioxole-5,6-diamine,dihydrochloride (9CI); |
| CAS: | 81864-15-5 |
| Molecular Formula: | C7H10Cl2N2O2 |
| Molecular Weight: | 225.07 |
| InChI: | InChI=1/C7H8N2O2.2ClH/c8-4-1-6-7(2-5(4)9)11-3-10-6;;/h1-2H,3,8-9H2;2*1H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 247-249 °C |
| Flash Point: | 192.4°C |
| Boiling Point: | 394.6°C at 760 mmHg |
| Stability: | Light Sensitive |
| Appearance: | light brown solid |
| Specification: | Light Brown Solid usageEng:A highly sensitive reagent for a-keto acids. A fluorometric labeling reagent Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 192.4°C |
| Storage Temperature: | −20°C |
| Usage: | A highly sensitive reagent for a-keto acids. A fluorometric labeling reagent |
| Safety Data | |
 |
|
