| Identification |
| Name: | L-Proline,1-[(2S)-3-(benzoylthio)-2-methyl-1-oxopropyl]-4-(phenylthio)-, (4S)- |
| Synonyms: | L-Proline,1-[3-(benzoylthio)-2-methyl-1-oxopropyl]-4-(phenylthio)-, [1(R*),2a,4a]-;UNII-290ZY759PI;Zofenoprilum [Latin];Zofenoprilum; |
| CAS: | 81872-10-8 |
| EINECS: | 201-705-8 |
| Molecular Formula: | C22H23NO4S2 |
| Molecular Weight: | 429.5523 |
| InChI: | InChI=1/C22H23NO4S2/c1-15(14-28-22(27)16-8-4-2-5-9-16)20(24)23-13-18(12-19(23)21(25)26)29-17-10-6-3-7-11-17/h2-11,15,18-19H,12-14H2,1H3,(H,25,26)/t15-,18+,19+/m1/s1 |
| Molecular Structure: |
![(C22H23NO4S2) L-Proline,1-[3-(benzoylthio)-2-methyl-1-oxopropyl]-4-(phenylthio)-, [1(R*),2a,4a]-;UNII-290ZY759PI;Z...](https://img.guidechem.com/casimg/81872-10-8.gif) |
| Properties |
| Melting Point: | 129-131.5 °C(lit.)
|
| Density: | 1.34 g/cm3 |
| Refractive index: | 1.658 |
| Specification: |
L-Proline,1-[(2S)-3-(benzoylthio)-2-methyl-1-oxopropyl]-4-(phenylthio)-, (4S)- with cas registry number of 81872-10-8 is also called Zofenopril ; Zofenopril [INN:BAN] ; UNII-290ZY759PI ; Zofenoprilum ; Zofenoprilum [Latin] ; L-Proline, 1-(3-(benzoylthio)-2-methyl-1-oxopropyl)-4-(phenylthio)-, (1(R*),2alpha,4alpha)- ; (4S)-N-[3-(Benzoylsulfanyl)-2(S)-methylpropionyl]-4-(phenylsulfanyl)-L-proline .
|
| Storage Temperature: | 2-8°C |
| Color: | light yellow |
| Safety Data |
| Hazard Symbols |
Xn: Harmful
Xi: Irritant
|
| |
 |