| Identification | |
| Name: | 2-Hepten-4-one,5-methyl- |
| Synonyms: | 5-methyl-2-hepten-4-one,99%;5-methyl-2-hepten-4-one 98% predominan; |
| CAS: | 81925-81-7 |
| Molecular Formula: | C8H14O |
| Molecular Weight: | 126.2 |
| InChI: | InChI=1/C8H14O/c1-4-6-8(9)7(3)5-2/h4,6-7H,5H2,1-3H3/b6-4+/t7-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1224 |
| Density: | 0.845 |
| Refractive index: | 1.444 |
| Specification: |
2-Hepten-4-one,5-methyl- , with CAS number of 81925-81-7, can be called 5-methyl-2-hepten-4-on ; filbertone ; 5-methyl-2-hepten-4-one ; 5-methyl-2-hepten-4-one 98% predominan ; 5-methyl-2-hepten-4-one,99% ; 5-methyl-2-hept-4-one . |
| Packinggroup: | III |
| Safety Data | |
 |
|
