| Identification | |
| Name: | Benzenepropanamine,N-methyl-g-(2-methylphenoxy)-,hydrochloride (1:1), (gR)- |
| CAS: | 82248-59-7 |
| Molecular Formula: | C17H22ClNO |
| Molecular Weight: | 291.82 |
| InChI: | InChI=1/C17H21NO.ClH/c1-14-8-6-7-11-16(14)19-17(12-13-18-2)15-9-4-3-5-10-15;/h3-11,17-18H,12-13H2,1-2H3;1H/t17-;/m1./s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 164.1°C |
| Boiling Point: | 389°C at 760 mmHg |
| Appearance: | solid |
| Specification: | White Solid usageEng:A Norepinephrine reuptake inhibitor Safety Statements:22-24/25 22:Do not breathe dust 24/25:Avoid contact with skin and eyes |
| Flash Point: | 164.1°C |
| Usage: | A Norepinephrine reuptake inhibitor |
| Safety Data | |
 |
|
