| Identification | |
| Name: | Furan, 2-bromo-5-nitro- |
| Synonyms: | 2-Bromo-5-nitrofuran;NSC 32225 |
| CAS: | 823-73-4 |
| Molecular Formula: | C4H2 Br N O3 |
| Molecular Weight: | 191.97 |
| InChI: | InChI=1/C4H2BrNO3/c5-3-1-2-4(9-3)6(7)8/h1-2H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 47°C |
| Flash Point: | 80.6°C |
| Boiling Point: | 118 °C / 15mmHg |
| Density: | 1.914g/cm3 |
| Refractive index: | 1.567 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 80.6°C |
| Safety Data | |
 |
|
