| Identification | |
| Name: | Sodium 4-nitrophenoxide, hydrate |
| Synonyms: | 4-Nitrophenol sodium salt; sodium p-nitrophenolate; 4-Nitropheol Sodium Salt; P-Nitro phenol sodium salt |
| CAS: | 824-78-2 |
| EINECS: | 212-536-4 |
| Molecular Formula: | C6H4NNaO3 |
| Molecular Weight: | 139.1088 |
| InChI: | InChI=1S/C6H5NO3/c8-6-3-1-5(2-4-6)7(9)10/h1-4,8H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1759 |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong acids. |
| Water Solubility: | Stability Stable. Incompatible with strong oxidizing agents, strong acids. Toxicology Harmful if swallowed, inhaled or absorbed through the skin.Danger of cumulative effects. Corrosive. |
| Solubility: |
|
| Appearance: | yellow orange crystals |
| Specification: | solid |
| Report: | Reported in EPA TSCA Inventory. Safety Profile
Low toxicity by inhalation. Decomposes violently when heated. When heated to decomposition it emits toxic fumes of NOx and Na2O. See also NITRO COMPOUNDS of AROMATIC HYDROCARBONS and SODIUM COMPOUNDS. |
| Packinggroup: | III |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Store protected from moisture. |
| Color: | Colorless to slightly yellow crystals YELLOW TO BROWN SOLID |
| Usage: | Parathion & methylparathion are made by chlorinating the appropriate dialkyl dithiophosphate and subsequent reaction of the intermediate dialkyl thiophosphoric chloride with sodium p-nitrophenolate. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
