Identification |
Name: | Ofloxacin |
Synonyms: | Exocin;Floxin (TN);HOE 280;(+/-)-9-Fluoro-2,3-dihydro-3-methyl-10-(4-methyl-1-piperazinyl)-7-oxo-7H-pyrido[1,2,3-de]-1,4-benzoxazine-6-carboxylic acid;Tarivid;DL-8280;Visiren;Prestwick_600;DL 8280;Ocuflox;OFX;Ofloxacin (JP14/USP);ORF 18489;Floxin;OFLX;7H-Pyrido[1,2,3-de]-1,4-benzoxazine-6- carboxylic acid,9-fluoro-2,3-dihydro-3- methyl-10-(4-methyl-1-piperazinyl)-7-oxo-;Ofloxacin (COS);Levoflxacin; |
CAS: | 82419-36-1 |
Molecular Formula: | C18H20FN3O4 |
Molecular Weight: | 361.367503 |
InChI: | InChI=1S/C18H20FN3O4/c1-10-9-26-17-14-11(16(23)12(18(24)25)8-22(10)14)7-13(19)15(17)21-5-3-20(2)4-6-21/h7-8,10H,3-6,9H2,1-2H3,(H,24,25) |
Molecular Structure: |
 |
Properties |
Density: | 1.48 g/cm3 |
Stability: | Stable if stored as directed.. |
Solubility: | Insoluble |
Appearance: | Off-white solid |
Specification: | Off-White Solid usageEng:Fluorinated quinolone antibacterial Safety Statements:26-36/37/39-24/25-22-37/39 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection 24/25:Avoid contact with skin and eyes 22:Do not breathe dust 37/39:Wear suitable protective clothing, gloves and eye/face
protection |
Usage: | Fluorinated quinolone antibacterial |
Safety Data |
Hazard Symbols |
Xi:Irritant
|
|
 |