| Identification | |
| Name: | Propanedioic acid,2-cyclopentyl-, 1,3-dimethyl ester |
| Synonyms: | Propanedioicacid, cyclopentyl-, dimethyl ester (9CI); Dimethyl cyclopentylmalonate |
| CAS: | 82491-60-9 |
| Molecular Formula: | C10H16 O4 |
| Molecular Weight: | 200.23 |
| InChI: | InChI=1/C10H16O4/c1-13-9(11)8(10(12)14-2)7-5-3-4-6-7/h7-8H,3-6H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 109.9°C |
| Boiling Point: | 240.9°C at 760 mmHg |
| Density: | 1,09 g/cm3 |
| Refractive index: | 1.462 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 109.9°C |
| Safety Data | |
 |
|
