| Identification | |
| Name: | 1,2,3,4-Tetrahydro-6,7-dimethoxy-3-isoquinolinecarboxylic acid hydrochloride |
| Synonyms: | 6,7-Dimethoxy-L-1,2,3,4-tetrahydroisoquinoline 3-carboxylic acid hydrochloride;3-Isoquinolinecarboxylicacid, 1,2,3,4-tetrahydro-6,7-dimethoxy-, hydrochloride, (3S)- (9CI);3-Isoquinolinecarboxylic acid, 1,2,3,4-tetrahydro-6,7-dimethoxy-,hydrochloride, (S)-;3-Isoquinolinecarboxylicacid, 1,2,3,4-tetrahydro-6,7-dimethoxy-, hydrochloride (1:1), (3S)-;(S)-6,7-Dimethoxy-1,2,3,4-tetrahydro-3-isoquinolinecarboxylic acid hydrochloride; |
| CAS: | 82586-62-7 |
| EINECS: | 255-610-1 |
| Molecular Formula: | C12H15NO4.HCl |
| Molecular Weight: | 273.72 |
| InChI: | InChI=1/C12H15NO4.ClH/c1-16-10-4-7-3-9(12(14)15)13-6-8(7)5-11(10)17-2;/h4-5,9,13H,3,6H2,1-2H3,(H,14,15);1H/t9-;/m0./s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 216.7 ºC |
| Boiling Point: | 434.8ºC at 760 mmHg |
| Appearance: | off-white crystalline powder |
| Specification: | White Solid usageEng:Moexipril intermediate Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 216.7 ºC |
| Storage Temperature: | Hygroscopic, Refrigerator, Under Inert Atmosphere |
| Usage: | Moexipril intermediate |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
