| Identification | |
| Name: | Phenol,4-(butoxymethyl)-2-methoxy- |
| Synonyms: | Hotact VBE;Vanillyl butyl ether; |
| CAS: | 82654-98-6 |
| Molecular Formula: | C12H18O3 |
| Molecular Weight: | 210.2695 |
| InChI: | InChI=1/C12H18O3/c1-3-4-7-15-9-10-5-6-11(13)12(8-10)14-2/h5-6,8,13H,3-4,7,9H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 140 ºC |
| Boiling Point: | 307.9 ºC at 760 mmHg |
| Density: | 1.048 g/cm3 |
| Refractive index: | 1.516 |
| Appearance: | Light yellow liquid |
| Specification: |
Phenol,4-(butoxymethyl)-2-methoxy- with cas registry number of 82654-98-6 is also called 4-(Butoxymethyl)-2-methoxyphenol ; Butyl vanillyl ether ; FEMA No. 3796 ; Vanillyl butyl ether . |
| Flash Point: | 140 ºC |
| Safety Data | |
 |
|
