| Specification: |
5-Fluoro-2-trifluoromethylaniline with the cas number 827-20-3, is also named 5-fluoro-2-(trifluoromethyl)aniline by IUPAC. It belongs to the Aniline categorie. This chemical is harmful to the environment, especially can cause the water pollution.
When use this chemical, please be cautious and take emergency measures:
Firstly, when skin contact, please immediately remove contaminated clothing, using soap water or water to wash skin thoroughly. Seek medical advice.
Secondly, in case of eye contact, please flush thoroughly immediately with plenty of liquid physiological saline at least 15 minutes. Seek medical advice.
Thirdly, in case of inhalation, rapidly run from the field to fresh air. maintain respiratory tract unobstructed. If no breathing, provide oxygen. If stop breathing, perform mouth-to-mouth breathing. Seek medical advice.
AT last, in case of eating, drink enough water, spits. Seek medical advice.
You can still convert the following datas into molecular structure :
1. SMILES:FC(F)(F)c1ccc(F)cc1N
2. InChI=1/C7H5F4N/c8-4-1-2-5(6(12)3-4)7(9,10)11/h1-3H,12H2
|