| Identification | |
| Name: | Furo[3,4-c]pyridin-7-ol,3-(4-chlorophenyl)-1,3-dihydro-6-methyl-, hydrochloride (1:1) |
| Synonyms: | Furo[3,4-c]pyridin-7-ol,3-(4-chlorophenyl)-1,3-dihydro-6-methyl-, hydrochloride (9CI); BN 1270;Cicletanine hydrochloride; Coverine; Justar; Secletan; Tenstaten |
| CAS: | 82747-56-6 |
| Molecular Formula: | C14H12 Cl N O2 . Cl H |
| Molecular Weight: | 261.7036 |
| InChI: | InChI=1/C14H12ClNO2.ClH/c1-8-13(17)12-7-18-14(11(12)6-16-8)9-2-4-10(15)5-3-9;/h2-6,14,17H,7H2,1H3;1H |
| Molecular Structure: | ![(C14H12ClNO2.ClH) Furo[3,4-c]pyridin-7-ol,3-(4-chlorophenyl)-1,3-dihydro-6-methyl-, hydrochloride (9CI); BN 1270;Cicle...](https://img1.guidechem.com/chem/e/dict/119/82747-56-6.jpg) |
| Properties | |
| Flash Point: | 223.7°C |
| Boiling Point: | 446.3°Cat760mmHg |
| Density: | 1.351g/cm3 |
| Specification: | Pink Solid usageEng:A new antihypertensive agent; exhibited a natriuretic effect comparable to that of hydrochlorothiazide and furosemide within 7 h. A furopyridine derivative with antihypertensive and diuretic properties |
| Flash Point: | 223.7°C |
| Storage Temperature: | Refrigerator |
| Usage: | A new antihypertensive agent; exhibited a natriuretic effect comparable to that of hydrochlorothiazide and furosemide within 7 h. A furopyridine derivative with antihypertensive and diuretic properties |
| Safety Data | |
 |
|
