| Identification | |
| CAS: | 828-01-3 |
| EINECS: | 225-014-6 |
| Molecular Formula: | C9H10O3 |
| Molecular Weight: | 166.1739 |
| InChI: | InChI=1S/C9H10O3/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8,10H,6H2,(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.261 g/cm3 |
| Refractive index: | 1.656 |
| Water Solubility: | 50 mg/ml-clear to slightly hazy, cololess to light yellow solution |
| Solubility: | 50 mg/ml-clear to slightly hazy, cololess to light yellow solution |
| Appearance: | White to off white powder |
| Storage Temperature: | 2-8°C |
| Safety Data | |
 |
|
