| Identification |
| Name: | 1H-Indene-1,3(2H)-dione,2-phenyl- |
| Synonyms: | 1,3-Indandione,2-phenyl- (6CI,8CI); 2-Phenyl-1,3-diketohydrindene; 2-Phenyl-1,3-indandione;2-Phenyl-1,3-indanedione; 2-Phenyl-1H-indene-1,3(2H)-dione; 2-Phenylindandione;Athrombon; Bindan; Cronodione; Danedion; Danilon; Danilone; Diadilan; Dindevan;Dineval; Diophindane; Emandion; Emandione; Fenhydren; Fenilin; Fenindion;Hedulin; Hemolidione; Indema; Indion; Indon; NSC 41693; PID; Phenhydren;Phenillin; Phenindione; Phenylen; Phenylin; Phenylindione; Pindione;Rectadione; Theradione; Thrombasal; Tromazal; Trombol |
| CAS: | 83-12-5 |
| EINECS: | 201-454-4 |
| Molecular Formula: | C15H10 O2 |
| Molecular Weight: | 222.25 |
| InChI: | InChI=1/C15H10O2/c16-14-11-8-4-5-9-12(11)15(17)13(14)10-6-2-1-3-7-10/h1-9,16H |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2811 6.1/PG 3 |
| Melting Point: | 144-148 °C(lit.)
|
| Flash Point: | 208 |
| Boiling Point: | 243.3 °C (0.3 mmHg)
|
| Density: | 1.343g/cm3 |
| Refractive index: | 1.703 |
| Solubility: | PRACTICALLY INSOL IN COLD WATER; SOL IN CHLOROFORM; SLIGHTLY SOL IN WARM WATER; READILY SOL IN ALKALINE SOLN; SOL IN METHANOL, ETHANOL, ETHER, ACETONE, BENZENE |
| Packinggroup: | III |
| Flash Point: | 208 |
| Color: | LEAFLETS FROM ALCOHOL CREAMY WHITE TO PALE YELLOW CRYSTALS OR CRYSTALLINE POWDER |
| Safety Data |
| Hazard Symbols |
T: Toxic
|
| |
 |