| Identification | |
| Name: | 3-Methylindole |
| Synonyms: | 1/C9H9N/c1-7-6-10-9-5-3-2-4-8(7)9/h2-6,10H,1H;3-Methyl-4,5-benzopyrrole;3-methyl-2,3-dihydro-1H-indole;3-MI;1H-Indole, 3-methyl-;Skatol;beta-Methylindole;Indole, 3-methyl-;1H-Indole,3-methyl-;Scatole;3-Methyl-1H-indole;FEMA No. 3019;.beta.-Methylindole;3-methyl-H-indole;3-methyl indole (Skatole);Skatole; |
| CAS: | 83-34-1 |
| EINECS: | 201-471-7 |
| Molecular Formula: | C9H9N |
| Molecular Weight: | 131.18 |
| InChI: | InChI=1/C9H9N/c1-7-6-10-9-5-3-2-4-8(7)9/h2-6,10H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.11 g/cm3 |
| Stability: | Stable, but light-sensistive. Stench! Incompatible with strong oxidizing agents, strong acids, acid ahydrides, acid chlorides. Combustible. |
| Refractive index: | 1.5666 (100 C) |
| Solubility: | 0.45 g/L |
| Appearance: | white or slightly brown platelets |
| HS Code: | 29339920 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Light Sensitive |
| Color: | LEAVES FROM PETROLEUM ETHER; WHITE-BROWN SCALES White crystalline substance, browning upon aging. |
| Usage: | A highly fluorescent guanosine analogue, which in a dimethoxytrityl, phosphoramidite protected form, can be site-specifically inserted into oligonucleotides through a 3?5?phosphodiester linkage using an automated DNA synthesizer |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
