| Identification |
| Name: | 3-Methylsalicylic acid |
| Synonyms: | 2-Hydroxy-3-methylbenzoic acid; o-Cresotic acid; Methylsalicylicacid,98%; 2-hydroxy-m-toluic acid; Cresotic acid; o-Kresotinic Acid |
| CAS: | 83-40-9 |
| EINECS: | 201-473-8 |
| Molecular Formula: | C8H8O3 |
| Molecular Weight: | 152.15 |
| InChI: | InChI=1/C8H8O3/c1-5-3-2-4-6(7(5)9)8(10)11/h2-4,9H,1H3,(H,10,11) |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2811 |
| Density: | 1.304 g/cm3 |
| Stability: | Volatile in steam. |
| Solubility: | 1.5 g/L (20 oC) in water |
| Appearance: | White To Slightly Reddish Crystalline Solid |
| HS Code: | 29182990 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Toxicity is similar to salicylic acid. Used in manufacturing of dyes |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
