| Identification |
| Name: | 1-Naphthalenol,5-amino- |
| Synonyms: | 1-Naphthol,5-amino- (7CI,8CI);1-Amino-5-hydroxynaphthalene;1-Amino-5-naphthol;5-Amino-1-naphthalenol;5-Amino-1-naphthol;5-Amino-a-naphthol;5-Hydroxy-1-naphthalenamine;5-Hydroxy-1-naphthylamine;C.I. 76650;NSC 1499; |
| CAS: | 83-55-6 |
| EINECS: | 201-486-9 |
| Molecular Formula: | C10H9NO |
| Molecular Weight: | 159.19 |
| InChI: | InChI=1/C10H9NO/c11-9-5-1-4-8-7(9)3-2-6-10(8)12/h1-6,12H,11H2 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.281 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Appearance: | pale purple to brown-purple crystalline powder |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
