| Identification |
| Name: | Tricyclo-decan-9-yl-xanthate |
| Synonyms: | Carbonodithioicacid, O-(octahydro-4,7-methano-1H-inden-5-yl) ester, potassium salt (9CI);D 609;O-Tricyclo[5.2.1.02,6]dec-9-yl dithiocarbonate potassium salt;Potassium O-(octahydro-4,7-methano-1H-inden-5-yl) dithiocarbonate; |
| CAS: | 83373-60-8 |
| EINECS: | 280-379-9 |
| Molecular Formula: | C11H16KOS2 |
| Molecular Weight: | 266.33432 |
| InChI: | InChI=1S/C18H18O2/c1-3-5-13-7-9-18(20)16(11-13)14-8-10-17(19)15(12-14)6-4-2/h3-4,7-12,19-20H,1-2,5-6H2 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.24 g/cm3 |
| Water Solubility: | H2O: 300 mg/mL in water |
| Solubility: | H2O: 300 mg/mL in water |
| Appearance: | off-white powder |
| Biological Activity: | Selective competitive phosphatidyl choline-specific phospholipase C (PC-PLC) inhibitor (K i = 6.4 μ M); antiviral and antitumor agent. Suppresses LPS- and IFN γ -induced NO production (IC 50 = 20 mg/ml) and blocks oxidative glutamate toxicity in nerve cells. Antioxidant in vivo . |
| Storage Temperature: | 0-6°C |
| Color: | off-white |
| Safety Data |
| |
 |
