| Identification |
| Name: | Phenanthrenequinone |
| Synonyms: | 9,10-phenanthrenedione; 9,10-Phenanthraquinone; 9,10-Phenanthrenequinone; Phenanthrene chinone 95%; Phenanthrenechinone |
| CAS: | 84-11-7 |
| EINECS: | 201-515-5 |
| Molecular Formula: | C14H8O2 |
| Molecular Weight: | 208.22 |
| InChI: | InChI=1/C14H8O2/c15-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14(13)16/h1-8H |
| Molecular Structure: |
 |
| Properties |
| Transport: | 25kgs |
| Density: | 1.308 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.659 |
| Solubility: | Insoluble |
| Appearance: | yellow cystalline powder |
| Specification: |
Chemical Stability: Stable under normal temperatures and pressures.?
Incompatibilities with Other Materials Strong oxidizing agents.?
Hazardous Decomposition Products Carbon monoxide, irritating and toxic fumes and gases, carbon dioxide.?
Conditions to Avoid: Incompatible materials.?
Hazardous Polymerization Has not been reported.
?
|
| Report: |
Reported in EPA TSCA Inventory. EPA Genetic Toxicology Program.
|
| Packinggroup: | III |
| HS Code: | 29146990 |
| Color: | ORANGE-RED CRYSTALS PLATES |
| Usage: | Organic synthesis, dyes. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |