| Identification |
| Name: | 10H-Phenothiazine-10-propanamine,N,N,b-trimethyl- |
| CAS: | 84-96-8 |
| EINECS: | 201-577-3 |
| Molecular Formula: | C18H22 N2 S |
| Molecular Weight: | 298.48 |
| InChI: | InChI=1/C18H22N2S/c1-14(12-19(2)3)13-20-15-8-4-6-10-17(15)21-18-11-7-5-9-16(18)20/h4-11,14H,12-13H2,1-3H3 |
| Molecular Structure: |
![(C18H22N2S) Phenothiazine,10-[3-(dimethylamino)-2-methylpropyl]- (6CI,8CI); (?à)-Alimemazine; (?à)-Trimeprazin...](https://img1.guidechem.com/chem/e/dict/32/84-96-8.jpg) |
| Properties |
| Melting Point: | 68 ºC |
| Flash Point: | 208°C |
| Boiling Point: | 420.3°Cat760mmHg |
| Density: | 1.203 g/cm3 |
| Stability: | No data. |
| Water Solubility: | 0.942 MG/L |
| Solubility: | 0.942 mg/L in water |
| Flash Point: | 208°C |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Color: | CRYSTALS |
| Usage: | Medication (vet):. |
| Safety Data |
| |
 |
