| Identification | |
| Name: | Bilberry Extract |
| Synonyms: | Bilberry,ext.;Eridiarom;Myrtocyan;Bilberry Extract/ Mulberry Fruit Extract;Vaccinium myrtillus,ext.; |
| CAS: | 84082-34-8 |
| EINECS: | 281-983-5 |
| Molecular Formula: | C27H31O16 |
| Molecular Weight: | 611.53 |
| InChI: | InChI=1S/C10H13N5O3S/c11-10-13-8-7(9(19)14-10)12-3-15(8)6-1-4(17)5(2-16)18-6/h3-6,16-17H,1-2H2,(H3,11,13,14,19)/t4-,5+,6+/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Appearance: | Purplish Powder |
| Specification: |
The Vaccinium myrtillus,ext., with the cas registry number 84082-34-8, has other names as bilberry extract 25%, blue tocal bilberry seed oil, vaccinium myrtillus, and so on. With the system Generated Number of 0084082348, its molecular formula is C27H31O16 and has the molecular weight of 611.53. Besides, its product categories are including natural plant extract; plant extract. As to its usage, the extract from Vaccinium myrtillus contains 36% anthocyanosides (including 3-O-arabinosides, 3-O-glucosides, and 3-O-galactosides), as well as sugars, aliphatic acids, polyphenols, flavan-3-ols, and flavonol glycosides. |
| Safety Data | |
 |
|
