Magnesium,bis[mono(phenylmethyl) propanedioato-O',O'']-, (T-4)- (9CI) (84133-21-1)

This chemical is called Magnesium monobenzyl malonate, and its systematic name is magnesium bis[3-(benzyloxy)-3-oxopropanoate]. With the molecular formula of C₂₀H₁₈MgO₈, its molecular weight is 410.66. The CAS registry number of this chemical is 84133-21-1.

Other characteristics of the Magnesium monobenzyl malonate can be summarised as followings: (1)#H bond acceptors: 8; (2)#H bond donors: 2; (3)#Freely Rotating Bonds: 10; (4)Polar Surface Area: 132.86 Å². 

You can still convert the following datas into molecular structure: 
(1)SMILES: [Mg+2].[O-]C(=O)CC(=O)OCc1ccccc1.[O-]C(=O)CC(=O)OCc1ccccc1
(2)InChI: InChI=1/2C10H10O4.Mg/c2*11-9(12)6-10(13)14-7-8-4-2-1-3-5-8;/h2*1-5H,6-7H2,(H,11,12);/q;;+2/p-2
(3)InChIKey: HWOBBQVNZBIHFX-NUQVWONBAF
(4)Std. InChI: InChI=1S/2C10H10O4.Mg/c2*11-9(12)6-10(13)14-7-8-4-2-1-3-5-8;/h2*1-5H,6-7H2,(H,11,12);/q;;+2/p-2
(5)Std. InChIKey: HWOBBQVNZBIHFX-UHFFFAOYSA-L