| Identification | |
| Name: | 1,2-Benzisoxazole,5-fluoro-3-(4-piperidinyl)-, hydrochloride (1:1) |
| Synonyms: | 1,2-Benzisoxazole,5-fluoro-3-(4-piperidinyl)-, monohydrochloride (9CI);4-(5-Fluoro-1,2-benzisoxazol-3-yl)piperidinehydrochloride;5-Fluoro-3-piperidin-4-yl-1,2-benzisoxazole hydrochloride; |
| CAS: | 84163-16-6 |
| Molecular Formula: | C12H14ClFN2O |
| Molecular Weight: | 256.7 |
| InChI: | InChI=1/C12H13FN2O.ClH/c13-9-1-2-11-10(7-9)12(15-16-11)8-3-5-14-6-4-8;/h1-2,7-8,14H,3-6H2;1H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 300-301 |
| Flash Point: | 170.9°C |
| Boiling Point: | 359°C at 760 mmHg |
| Specification: | Off-White Solid usageEng:An intermediate of 5-Fluoro Risperidone (F595925). |
| Flash Point: | 170.9°C |
| Storage Temperature: | Hygroscopic, Refrigerator, Under Inert Atmosphere |
| Usage: | An intermediate of 5-Fluoro Risperidone (F595925). |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
