| Identification | |
| Name: | Acetamide,2-cyano-N-(2,4-dichloro-5-methoxyphenyl)- |
| Synonyms: | N-(2,4-Dichloro-5-methoxyphenyl)-2-cyanoacetamide; |
| CAS: | 846023-24-3 |
| Molecular Formula: | C10H8Cl2N2O2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C10H8Cl2N2O2/c1-16-9-5-8(6(11)4-7(9)12)14-10(15)2-3-13/h4-5H,2H2,1H3,(H,14,15) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 233.4°C |
| Boiling Point: | 462.4°C at 760 mmHg |
| Density: | 1.436g/cm3 |
| Refractive index: | 1.598 |
| Specification: |
2-Cyanobenzenesulphonyl chloride ,with CAS number of 163563-64-2,can be called acetamide, 2-cyano-N-(2,4-dichloro-5-methoxyphenyl)- . 2-Cyano-N-(2,4dichloro-5-methoxyphenyl)acetamide (CAS NO.163563-64-2) is a Pale yellow powder. |
| Flash Point: | 233.4°C |
| Safety Data | |
 |
|
