Identification |
Name: | Boronic acid,B-[2-methyl-4-(phenylmethoxy)phenyl]- |
Synonyms: | Boronicacid, [2-methyl-4-(phenylmethoxy)phenyl]- (9CI);4-Benzyloxy-2-methylphenylboronic acid |
CAS: | 847560-49-0 |
Molecular Formula: | C14H15 B O3 |
Molecular Weight: | 242.08 |
InChI: | InChI=1/C14H15BO3/c1-11-9-13(7-8-14(11)15(16)17)18-10-12-5-3-2-4-6-12/h2-9,16-17H,10H2,1H3 |
Molecular Structure: |
|
Properties |
Melting Point: | 154-158 |
Flash Point: | 217.6°C |
Boiling Point: | 436.2°C at 760 mmHg |
Density: | 1.17g/cm3 |
Refractive index: | 1.585 |
Specification: | usageEng:suzuki reaction Safety Statements:26-36/37/39-36 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection 36:Wear suitable protective clothing |
HS Code: | 29310095 |
Flash Point: | 217.6°C |
Usage: | suzuki reaction |
Safety Data |
|
|