| Identification | |
| Name: | 4-Pyridinecarboxylicacid, 2-bromo-3-iodo- |
| Synonyms: | 2-BROMO-3-IODO-ISONICOTINIC ACID;2-BROMO-3-IODO-4-PYRIDINECARBOXYLIC ACID |
| CAS: | 848243-29-8 |
| Molecular Formula: | C6H3 Br I N O2 |
| Molecular Weight: | 327.9 |
| InChI: | InChI=1/C6H3BrINO2/c7-5-4(8)3(6(10)11)1-2-9-5/h1-2H,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 246.7°C |
| Boiling Point: | 484.3°C at 760 mmHg |
| Density: | 2.457g/cm3 |
| Refractive index: | 1.705 |
| Specification: |
The cas register number of 2-Bromo-3-iodoisonicotinic acid is 848243-29-8. It also can be called as 2-Bromo-3-iodo-4-pyridinecarboxylic acid and the Systematic name about this chemical is 2-bromo-3-iodopyridine-4-carboxylic acid. Physical properties about 2-Bromo-3-iodoisonicotinic acid are: (1)ACD/LogP: 1.61; (2)# of Rule of 5 Violations: 0; (3)ACD/BCF (pH 5.5): 1; (4)ACD/BCF (pH 7.4): 1; (5)ACD/KOC (pH 5.5): 1; (6)ACD/KOC (pH 7.4): 1; (7)#H bond acceptors: 3; (8)#H bond donors: 1; (9)#Freely Rotating Bonds: 1; (10)Polar Surface Area: 50.19Å2; (11)Index of Refraction: 1.705; (12)Molar Refractivity: 51.87 cm3; (13)Molar Volume: 133.4 cm3; (14)Surface Tension: 72.6 dyne/cm; (15)Density: 2.457 g/cm3; (16)Flash Point: 246.7 °C; (17)Enthalpy of Vaporization: 78.95 kJ/mol; (18)Boiling Point: 484.3 °C at 760 mmHg; (19)Vapour Pressure: 3.43E-10 mmHg at 25°C. |
| Flash Point: | 246.7°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
