| Identification | |
| Name: | Hexahydrophthalic anhydride |
| Synonyms: | 1,2-Cyclohexanedicarboxylic anhydride; HHPA; cyclohexanedicarboxylic anhydridel; 1,2-cyclohexane- dicarboxylic anhydride, mixture of cis and trans |
| CAS: | 85-42-7 |
| EINECS: | 201-604-9 |
| Molecular Formula: | C8H10O3 |
| Molecular Weight: | 154.16 |
| InChI: | InChI=1/C8H10O3/c9-7-5-3-1-2-4-6(5)8(10)11-7/h5-6H,1-4H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 220kgs |
| Density: | 1.18 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.536 |
| Water Solubility: | Decomposes AUTOIGNITION |
| Solubility: | Decomposes AUTOIGNITION |
| Appearance: | Light Yellow Crystalline Powder or Liquid |
| Specification: |
1,3-Isobenzofurandione, hexahydro- (CAS NO.85-42-7) is also called as 1,2-Cyclohexanedicarboxylic acid anhydride ; Araldite HT 907 ; EINECS 201-604-9 ; HHPA ; Hexahydrophthalic acid anhydride ; Hexahydrophthalic anhydride ; Lekutherm Hardener H ; NSC 8622 ; NT 907 ; Cyclohexane-1,2-dicarboxylic anhydride ; 1,2-Cyclohexanedicarboxylic anhydride . |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Store protected from moisture. |
| Sensitive: | Moisture Sensitive |
| Usage: | Induces experimental asthma in immunized guinea pigs. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
