| Identification | |
| Name: | 1,3-Isobenzofurandione,3a,4,7,7a-tetrahydro- |
| Synonyms: | 4-Cyclohexene-1,2-dicarboxylicanhydride (8CI);1,2,3,6-Tetrahydrophthalic acid anhydride;3a,4,7,7a-Tetrahydro-1,3-isobenzofurandione;Cyclohexene-4,5-dicarboxylic anhydride;HK 019;KBH 1098;Maleic anhydride-butadiene adduct;NSC 82642;Rikacid TH;Rikacid THPA;Tetrahydrophthalic acid anhydride;D4-Tetrahydrophthalic anhydride; |
| CAS: | 85-43-8 |
| EINECS: | 201-605-4 |
| Molecular Formula: | C8H8O3 |
| Molecular Weight: | 152.16 |
| InChI: | InChI=1S/C8H8O3/c9-7-5-3-1-2-4-6(5)8(10)11-7/h1-2,5-6H,3-4H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2698 |
| Density: | 1,375 g/cm3 |
| Solubility: | Slightly soluble in petroleum ether and ethyl ether; soluble in benzene In water, 1,600 mg/L at 25 deg C (est) |
| Appearance: | WHITE CRYSTALLINE POWDER |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Packinggroup: | III |
| Color: | White crystalline powder |
| Safety Data | |
| Hazard Symbols | |
 |
|
