| Identification | |
| Name: | Phthalic anhydride |
| Synonyms: | 2,5-Isobenzofurandione; Phthalic anhydride 99+ %; 2-benzofuran-1,3-dione |
| CAS: | 85-44-9 |
| EINECS: | 201-607-5 |
| Molecular Formula: | C8H4O3 |
| Molecular Weight: | 148.12 |
| InChI: | InChI=1/C8H4O3/c9-7-5-3-1-2-4-6(5)8(10)11-7/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2214 |
| Density: | 1.53 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents, strong bases, moisture, strong acids. Dust may form an explosive mixture with air. |
| Refractive index: | 1.646 |
| Solubility: | 0.62 g/100g reacts slowly in water |
| Appearance: | white crystalline solid with choking odour |
| Packinggroup: | III |
| Storage Temperature: | Store at RT. |
| Sensitive: | Moisture Sensitive |
| Color: | White, lustrous needles Colorless or pale yellow solid flakes Colorless needles; monoclinic or rhombic prisms White needles from alcohol and benzene White solid (flake) or a clear colorless liquid (molten) |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
