| Identification | |
| Name: | 2,3-Difluoro-4-iodo-pyridine |
| Synonyms: | 2,3-Difluoro-4-iodopyridine; Pyridine, 2,3-difluoro-4-iodo- |
| CAS: | 851386-34-0 |
| Molecular Formula: | C5H2F2IN |
| Molecular Weight: | 240.98 |
| InChI: | InChI=1/C5H2F2IN/c6-4-3(8)1-2-9-5(4)7/h1-2H |
| Molecular Structure: |  |
| Properties | |
| Density: | 2.129 |
| Refractive index: | 1.572 |
| Specification: |
The 2,3-Difluoro-4-iodopyridine with the CAS number 851386-34-0 is also called Pyridine,2,3-difluoro-4-iodo-. Its molecular formula is C5H2F2IN. The product category is API intermediates. This chemical is a kind of organics. It should be stored in dry and cool environment. The properties of the 2,3-Difluoro-4-iodopyridine are: (1)ACD/LogP: 3.53; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 2; (4)ACD/LogD (pH 7.4): 2; (5)ACD/BCF (pH 5.5): 10; (6)ACD/BCF (pH 7.4): 10; (7)ACD/KOC (pH 5.5): 186; (8)ACD/KOC (pH 7.4): 186; (9)#H bond acceptors: 1; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 0; (12)Polar Surface Area: 12.89 Å2; (13)Index of Refraction: 1.572; (14)Molar Refractivity: 37.238 cm3; (15)Molar Volume: 113.149 cm3; (16)Polarizability: 14.762×10-24cm3; (17)Surface Tension: 43.917 dyne/cm; (18)Enthalpy of Vaporization: 43.077 kJ/mol; (19)Vapour Pressure: 0.248 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
