| Identification | |
| Name: | b-D-Glucopyranoside, octyl 1-thio- |
| Synonyms: | 1-n-Octylb-D-thioglucopyranoside;Octyl b-D-thioglucopyranoside;Octyl b-thioglucoside;S-Octyl-1-thio-b-D-glucopyranose;n-Octyl b-D-thioglucopyranoside; |
| CAS: | 85618-21-9 |
| Molecular Formula: | C14H28O5S |
| Molecular Weight: | 308.43 |
| InChI: | InChI=1/C14H28O5S/c1-2-3-4-5-6-7-8-20-14-13(18)12(17)11(16)10(9-15)19-14/h10-18H,2-9H2,1H3/t10-,11-,12?,13-,14+/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 125-131 oC |
| Density: | 1.21 g/cm3 |
| Refractive index: | 1.547 |
| Alpha: | -46 o (C=1, MEOH) |
| Water Solubility: | soluble |
| Solubility: | Soluble in water |
| Appearance: | Colourless Waxy Semi-Solid |
| Specification: |
?beta-D-Glucopyranoside, octyl 1-thio- , its CAS NO. is 85618-21-9, the synonyms are? N-Octyl-beta-D-thioglucoside ; Octylthioglucoside . |
| Usage: | A non-ionic detergent for solubilization and reconstitution of membrane proteins of Escherichia coli |
| Safety Data | |
 |
|
